C10H11BrF6NO2+ — CID 11891287
[(1R,4R,6S,7S)-7-bromo-3,3-bis(trifluoromethyl)-2-azoniabicyclo[2.2.1]heptan-6-yl] acetate (PubChem CID 11891287) has the molecular formula C10H11BrF6NO2+ and a molecular weight of 371.10 g/mol. Its IUPAC name is [(1R,4R,6S,7S)-7-bromo-3,3-bis(trifluoromethyl)-2-azoniabicyclo[2.2.1]heptan-6-yl] acetate.
| Compound Name | [(1R,4R,6S,7S)-7-bromo-3,3-bis(trifluoromethyl)-2-azoniabicyclo[2.2.1]heptan-6-yl] acetate |
|---|---|
| PubChem CID | 11891287 |
| Molecular Formula | C10H11BrF6NO2+ |
| Molecular Weight | 371.10 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | [(1R,4R,6S,7S)-7-bromo-3,3-bis(trifluoromethyl)-2-azoniabicyclo[2.2.1]heptan-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H]2[C@H](Br)[C@@H]1[NH2+]C2(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H10BrF6NO2/c1-3(19)20-5-2-4-6(11)7(5)18-8(4,9(12,13)14)10(15,16)17/h4-7,18H,2H2,1H3/p+1/t4-,5-,6-,7+/m0/s1 |
| InChIKey | RMADYUJTAOPBEY-ZTYPAOSTSA-O |
| XLogP | 1.51 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.10 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|