About [4-acetyloxy-3-bromo-2-(pentafluoro-λ6-sulfanyl)cyclohexyl] acetate
[4-acetyloxy-3-bromo-2-(pentafluoro-λ6-sulfanyl)cyclohexyl] acetate (PubChem CID 134877948) has the molecular formula C10H14BrF5O4S
and a molecular weight of 405.18 g/mol. Its IUPAC name is [4-acetyloxy-3-bromo-2-(pentafluoro-λ6-sulfanyl)cyclohexyl] acetate.
Molecular Properties
| Compound Name | [4-acetyloxy-3-bromo-2-(pentafluoro-λ6-sulfanyl)cyclohexyl] acetate |
| PubChem CID | 134877948 |
| Molecular Formula | C10H14BrF5O4S |
| Molecular Weight | 405.18 g/mol |
| Exact Mass | 403.97 |
| IUPAC Name | [4-acetyloxy-3-bromo-2-(pentafluoro-λ6-sulfanyl)cyclohexyl] acetate |
| SMILES | CC(=O)OC1CCC(OC(C)=O)C(S(F)(F)(F)(F)F)C1Br |
| InChI | InChI=1S/C10H14BrF5O4S/c1-5(17)19-7-3-4-8(20-6(2)18)10(9(7)11)21(12,13,14,15)16/h7-10H,3-4H2,1-2H3 |
| InChIKey | ACHBURPVGVHCPN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.18 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [4-acetyloxy-3-bromo-2-(pentafluoro-λ6-sulfanyl)cyclohexyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-acetyloxy-3-bromo-2-(pentafluoro-λ6-sulfanyl)cyclohexyl] acetate?
The IUPAC name of [4-acetyloxy-3-bromo-2-(pentafluoro-λ6-sulfanyl)cyclohexyl] acetate (CID 134877948) is [4-acetyloxy-3-bromo-2-(pentafluoro-λ6-sulfanyl)cyclohexyl] acetate.
What is the SMILES notation for [4-acetyloxy-3-bromo-2-(pentafluoro-λ6-sulfanyl)cyclohexyl] acetate?
The canonical SMILES for [4-acetyloxy-3-bromo-2-(pentafluoro-λ6-sulfanyl)cyclohexyl] acetate is CC(=O)OC1CCC(OC(C)=O)C(S(F)(F)(F)(F)F)C1Br.
What is the InChIKey of [4-acetyloxy-3-bromo-2-(pentafluoro-λ6-sulfanyl)cyclohexyl] acetate?
The InChIKey is ACHBURPVGVHCPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BrF5O4S/c1-5(17)19-7-3-4-8(20-6(2)18)10(9(7)11)21(12,13,14,15)16/h7-10H,3-4H2,1-2H3.
What are the key properties of [4-acetyloxy-3-bromo-2-(pentafluoro-λ6-sulfanyl)cyclohexyl] acetate?
[4-acetyloxy-3-bromo-2-(pentafluoro-λ6-sulfanyl)cyclohexyl] acetate has a molecular weight of 405.18 g/mol, XLogP of 4.07, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-acetyloxy-3-bromo-2-(pentafluoro-λ6-sulfanyl)cyclohexyl] acetate is sourced from PubChem (CID 134877948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).