C10H9ClF8O2 — CID 100823394
[(1R,2S,4R,5R)-2-chloro-4,5-difluoro-4,5-bis(trifluoromethyl)cyclohexyl] acetate (PubChem CID 100823394) has the molecular formula C10H9ClF8O2 and a molecular weight of 348.62 g/mol. Its IUPAC name is [(1R,2S,4R,5R)-2-chloro-4,5-difluoro-4,5-bis(trifluoromethyl)cyclohexyl] acetate.
| Compound Name | [(1R,2S,4R,5R)-2-chloro-4,5-difluoro-4,5-bis(trifluoromethyl)cyclohexyl] acetate |
|---|---|
| PubChem CID | 100823394 |
| Molecular Formula | C10H9ClF8O2 |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | [(1R,2S,4R,5R)-2-chloro-4,5-difluoro-4,5-bis(trifluoromethyl)cyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@](F)(C(F)(F)F)[C@@](F)(C(F)(F)F)C[C@@H]1Cl |
| InChI | InChI=1S/C10H9ClF8O2/c1-4(20)21-6-3-8(13,10(17,18)19)7(12,2-5(6)11)9(14,15)16/h5-6H,2-3H2,1H3/t5-,6+,7+,8+/m0/s1 |
| InChIKey | NSDMPHHLQXQISE-LXGUWJNJSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|