C10H11ClF8O — CID 124865085
(1R,2S,4R,5R)-4-chloro-5-ethoxy-1,2-difluoro-1,2-bis(trifluoromethyl)cyclohexane (PubChem CID 124865085) has the molecular formula C10H11ClF8O and a molecular weight of 334.63 g/mol. Its IUPAC name is (1R,2S,4R,5R)-4-chloro-5-ethoxy-1,2-difluoro-1,2-bis(trifluoromethyl)cyclohexane.
| Compound Name | (1R,2S,4R,5R)-4-chloro-5-ethoxy-1,2-difluoro-1,2-bis(trifluoromethyl)cyclohexane |
|---|---|
| PubChem CID | 124865085 |
| Molecular Formula | C10H11ClF8O |
| Molecular Weight | 334.63 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | (1R,2S,4R,5R)-4-chloro-5-ethoxy-1,2-difluoro-1,2-bis(trifluoromethyl)cyclohexane |
| SMILES | CCO[C@@H]1C[C@](F)(C(F)(F)F)[C@](F)(C(F)(F)F)C[C@H]1Cl |
| InChI | InChI=1S/C10H11ClF8O/c1-2-20-6-4-8(13,10(17,18)19)7(12,3-5(6)11)9(14,15)16/h5-6H,2-4H2,1H3/t5-,6-,7+,8-/m1/s1 |
| InChIKey | SLTXLYZUZLOALQ-OOJXKGFFSA-N |
| XLogP | 4.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.63 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|