C6H8F2N2 — CID 142278530
2,2-difluoropiperidine-3-carbonitrile (PubChem CID 142278530) has the molecular formula C6H8F2N2 and a molecular weight of 146.14 g/mol. Its IUPAC name is 2,2-difluoropiperidine-3-carbonitrile.
| Compound Name | 2,2-difluoropiperidine-3-carbonitrile |
|---|---|
| PubChem CID | 142278530 |
| Molecular Formula | C6H8F2N2 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 2,2-difluoropiperidine-3-carbonitrile |
| SMILES | N#CC1CCCNC1(F)F |
| InChI | InChI=1S/C6H8F2N2/c7-6(8)5(4-9)2-1-3-10-6/h5,10H,1-3H2 |
| InChIKey | BSDFKURJRMBPBP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|