C14H15N5O2 — CID 134214774
4-(6-amino-2-ethynylpurin-9-yl)cyclohexane-1-carboxylic acid (PubChem CID 134214774) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 4-(6-amino-2-ethynylpurin-9-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(6-amino-2-ethynylpurin-9-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 134214774 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 4-(6-amino-2-ethynylpurin-9-yl)cyclohexane-1-carboxylic acid |
| SMILES | C#Cc1nc(N)c2ncn(C3CCC(C(=O)O)CC3)c2n1 |
| InChI | InChI=1S/C14H15N5O2/c1-2-10-17-12(15)11-13(18-10)19(7-16-11)9-5-3-8(4-6-9)14(20)21/h1,7-9H,3-6H2,(H,20,21)(H2,15,17,18) |
| InChIKey | NDZPLOUUWXFHHG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|