C17H23N5O — CID 134214744
4-[6-amino-9-(4-methylcyclohexyl)purin-2-yl]-2-methylbut-3-yn-2-ol (PubChem CID 134214744) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is 4-[6-amino-9-(4-methylcyclohexyl)purin-2-yl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[6-amino-9-(4-methylcyclohexyl)purin-2-yl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 134214744 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 4-[6-amino-9-(4-methylcyclohexyl)purin-2-yl]-2-methylbut-3-yn-2-ol |
| SMILES | CC1CCC(n2cnc3c(N)nc(C#CC(C)(C)O)nc32)CC1 |
| InChI | InChI=1S/C17H23N5O/c1-11-4-6-12(7-5-11)22-10-19-14-15(18)20-13(21-16(14)22)8-9-17(2,3)23/h10-12,23H,4-7H2,1-3H3,(H2,18,20,21) |
| InChIKey | FFXKVZVXGXBMSP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|