C21H22F2N2O5 — CID 134218271
(2R)-N-[(2,6-difluorophenyl)methyl]-9-hydroxy-2-methyl-8,10-dioxo-1,2,4,5,6,7-hexahydropyrido[1,2-d][1,4]oxazecine-11-carboxamide (PubChem CID 134218271) has the molecular formula C21H22F2N2O5 and a molecular weight of 420.41 g/mol. Its IUPAC name is (2R)-N-[(2,6-difluorophenyl)methyl]-9-hydroxy-2-methyl-8,10-dioxo-1,2,4,5,6,7-hexahydropyrido[1,2-d][1,4]oxazecine-11-carboxamide.
| Compound Name | (2R)-N-[(2,6-difluorophenyl)methyl]-9-hydroxy-2-methyl-8,10-dioxo-1,2,4,5,6,7-hexahydropyrido[1,2-d][1,4]oxazecine-11-carboxamide |
|---|---|
| PubChem CID | 134218271 |
| Molecular Formula | C21H22F2N2O5 |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | (2R)-N-[(2,6-difluorophenyl)methyl]-9-hydroxy-2-methyl-8,10-dioxo-1,2,4,5,6,7-hexahydropyrido[1,2-d][1,4]oxazecine-11-carboxamide |
| SMILES | C[C@@H]1Cn2cc(C(=O)NCc3c(F)cccc3F)c(=O)c(O)c2C(=O)CCCCO1 |
| InChI | InChI=1S/C21H22F2N2O5/c1-12-10-25-11-14(21(29)24-9-13-15(22)5-4-6-16(13)23)19(27)20(28)18(25)17(26)7-2-3-8-30-12/h4-6,11-12,28H,2-3,7-10H2,1H3,(H,24,29)/t12-/m1/s1 |
| InChIKey | XJBULLRPDGJGRO-GFCCVEGCSA-N |
| XLogP | 2.53 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |