C23H27F3N4O4 — CID 134219199
tert-butyl 3-[amino-[2-amino-5-[4-(trifluoromethoxy)phenyl]benzoyl]amino]pyrrolidine-1-carboxylate (PubChem CID 134219199) has the molecular formula C23H27F3N4O4 and a molecular weight of 480.49 g/mol. Its IUPAC name is tert-butyl 3-[amino-[2-amino-5-[4-(trifluoromethoxy)phenyl]benzoyl]amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[amino-[2-amino-5-[4-(trifluoromethoxy)phenyl]benzoyl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134219199 |
| Molecular Formula | C23H27F3N4O4 |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | tert-butyl 3-[amino-[2-amino-5-[4-(trifluoromethoxy)phenyl]benzoyl]amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N(N)C(=O)c2cc(-c3ccc(OC(F)(F)F)cc3)ccc2N)C1 |
| InChI | InChI=1S/C23H27F3N4O4/c1-22(2,3)34-21(32)29-11-10-16(13-29)30(28)20(31)18-12-15(6-9-19(18)27)14-4-7-17(8-5-14)33-23(24,25)26/h4-9,12,16H,10-11,13,27-28H2,1-3H3 |
| InChIKey | CDRWBCXBRPPQLQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 111.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|