C18H16F3N3O2 — CID 134219121
2-amino-N-but-3-ynyl-5-[4-(trifluoromethoxy)phenyl]benzohydrazide (PubChem CID 134219121) has the molecular formula C18H16F3N3O2 and a molecular weight of 363.34 g/mol. Its IUPAC name is 2-amino-N-but-3-ynyl-5-[4-(trifluoromethoxy)phenyl]benzohydrazide.
| Compound Name | 2-amino-N-but-3-ynyl-5-[4-(trifluoromethoxy)phenyl]benzohydrazide |
|---|---|
| PubChem CID | 134219121 |
| Molecular Formula | C18H16F3N3O2 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 2-amino-N-but-3-ynyl-5-[4-(trifluoromethoxy)phenyl]benzohydrazide |
| SMILES | C#CCCN(N)C(=O)c1cc(-c2ccc(OC(F)(F)F)cc2)ccc1N |
| InChI | InChI=1S/C18H16F3N3O2/c1-2-3-10-24(23)17(25)15-11-13(6-9-16(15)22)12-4-7-14(8-5-12)26-18(19,20)21/h1,4-9,11H,3,10,22-23H2 |
| InChIKey | PHJQOLWBCPXZFV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|