C22H18F3N7O2 — CID 146330631
2-amino-N-[(5-phenyltetrazol-1-yl)methyl]-5-[4-(trifluoromethoxy)phenyl]benzohydrazide (PubChem CID 146330631) has the molecular formula C22H18F3N7O2 and a molecular weight of 469.43 g/mol. Its IUPAC name is 2-amino-N-[(5-phenyltetrazol-1-yl)methyl]-5-[4-(trifluoromethoxy)phenyl]benzohydrazide.
| Compound Name | 2-amino-N-[(5-phenyltetrazol-1-yl)methyl]-5-[4-(trifluoromethoxy)phenyl]benzohydrazide |
|---|---|
| PubChem CID | 146330631 |
| Molecular Formula | C22H18F3N7O2 |
| Molecular Weight | 469.43 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 2-amino-N-[(5-phenyltetrazol-1-yl)methyl]-5-[4-(trifluoromethoxy)phenyl]benzohydrazide |
| SMILES | Nc1ccc(-c2ccc(OC(F)(F)F)cc2)cc1C(=O)N(N)Cn1nnnc1-c1ccccc1 |
| InChI | InChI=1S/C22H18F3N7O2/c23-22(24,25)34-17-9-6-14(7-10-17)16-8-11-19(26)18(12-16)21(33)31(27)13-32-20(28-29-30-32)15-4-2-1-3-5-15/h1-12H,13,26-27H2 |
| InChIKey | YNFQZNYTWOKRTE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 125.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|