About [methylimino(diphenoxy)-λ5-phosphanyl]imino-diphenoxyphosphanium
[methylimino(diphenoxy)-λ5-phosphanyl]imino-diphenoxyphosphanium (PubChem CID 134219885) has the molecular formula C25H23N2O4P2+
and a molecular weight of 477.42 g/mol. Its IUPAC name is [methylimino(diphenoxy)-λ5-phosphanyl]imino-diphenoxyphosphanium.
Molecular Properties
| Compound Name | [methylimino(diphenoxy)-λ5-phosphanyl]imino-diphenoxyphosphanium |
| PubChem CID | 134219885 |
| Molecular Formula | C25H23N2O4P2+ |
| Molecular Weight | 477.42 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | [methylimino(diphenoxy)-λ5-phosphanyl]imino-diphenoxyphosphanium |
| SMILES | CN=P(N=[P+](Oc1ccccc1)Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C25H23N2O4P2/c1-26-33(30-24-18-10-4-11-19-24,31-25-20-12-5-13-21-25)27-32(28-22-14-6-2-7-15-22)29-23-16-8-3-9-17-23/h2-21H,1H3/q+1 |
| InChIKey | UWUAKWCGPIGUMZ-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.42 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [methylimino(diphenoxy)-λ5-phosphanyl]imino-diphenoxyphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methylimino(diphenoxy)-λ5-phosphanyl]imino-diphenoxyphosphanium?
The IUPAC name of [methylimino(diphenoxy)-λ5-phosphanyl]imino-diphenoxyphosphanium (CID 134219885) is [methylimino(diphenoxy)-λ5-phosphanyl]imino-diphenoxyphosphanium.
What is the SMILES notation for [methylimino(diphenoxy)-λ5-phosphanyl]imino-diphenoxyphosphanium?
The canonical SMILES for [methylimino(diphenoxy)-λ5-phosphanyl]imino-diphenoxyphosphanium is CN=P(N=[P+](Oc1ccccc1)Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of [methylimino(diphenoxy)-λ5-phosphanyl]imino-diphenoxyphosphanium?
The InChIKey is UWUAKWCGPIGUMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23N2O4P2/c1-26-33(30-24-18-10-4-11-19-24,31-25-20-12-5-13-21-25)27-32(28-22-14-6-2-7-15-22)29-23-16-8-3-9-17-23/h2-21H,1H3/q+1.
What are the key properties of [methylimino(diphenoxy)-λ5-phosphanyl]imino-diphenoxyphosphanium?
[methylimino(diphenoxy)-λ5-phosphanyl]imino-diphenoxyphosphanium has a molecular weight of 477.42 g/mol, XLogP of 8.37, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [methylimino(diphenoxy)-λ5-phosphanyl]imino-diphenoxyphosphanium is sourced from PubChem (CID 134219885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).