C10H10ClF3O — CID 134225298
1-(3-chloro-4,5-dimethylphenyl)-2,2,2-trifluoroethanol (PubChem CID 134225298) has the molecular formula C10H10ClF3O and a molecular weight of 238.64 g/mol. Its IUPAC name is 1-(3-chloro-4,5-dimethylphenyl)-2,2,2-trifluoroethanol.
| Compound Name | 1-(3-chloro-4,5-dimethylphenyl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 134225298 |
| Molecular Formula | C10H10ClF3O |
| Molecular Weight | 238.64 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 1-(3-chloro-4,5-dimethylphenyl)-2,2,2-trifluoroethanol |
| SMILES | Cc1cc(C(O)C(F)(F)F)cc(Cl)c1C |
| InChI | InChI=1S/C10H10ClF3O/c1-5-3-7(4-8(11)6(5)2)9(15)10(12,13)14/h3-4,9,15H,1-2H3 |
| InChIKey | JWFSLMVKXZCNIG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.64 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |