C16H23N3S — CID 134232707
3-ethyl-N-[(5-imidazol-1-ylthiophen-2-yl)methyl]hex-5-en-1-amine (PubChem CID 134232707) has the molecular formula C16H23N3S and a molecular weight of 289.45 g/mol. Its IUPAC name is 3-ethyl-N-[(5-imidazol-1-ylthiophen-2-yl)methyl]hex-5-en-1-amine.
| Compound Name | 3-ethyl-N-[(5-imidazol-1-ylthiophen-2-yl)methyl]hex-5-en-1-amine |
|---|---|
| PubChem CID | 134232707 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 3-ethyl-N-[(5-imidazol-1-ylthiophen-2-yl)methyl]hex-5-en-1-amine |
| SMILES | C=CCC(CC)CCNCc1ccc(-n2ccnc2)s1 |
| InChI | InChI=1S/C16H23N3S/c1-3-5-14(4-2)8-9-17-12-15-6-7-16(20-15)19-11-10-18-13-19/h3,6-7,10-11,13-14,17H,1,4-5,8-9,12H2,2H3 |
| InChIKey | PYFPMOOJASMBQV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|