C18H25NOS — CID 134232787
3-ethyl-N-[(6-methoxy-1-benzothiophen-2-yl)methyl]hex-5-en-1-amine (PubChem CID 134232787) has the molecular formula C18H25NOS and a molecular weight of 303.47 g/mol. Its IUPAC name is 3-ethyl-N-[(6-methoxy-1-benzothiophen-2-yl)methyl]hex-5-en-1-amine.
| Compound Name | 3-ethyl-N-[(6-methoxy-1-benzothiophen-2-yl)methyl]hex-5-en-1-amine |
|---|---|
| PubChem CID | 134232787 |
| Molecular Formula | C18H25NOS |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 3-ethyl-N-[(6-methoxy-1-benzothiophen-2-yl)methyl]hex-5-en-1-amine |
| SMILES | C=CCC(CC)CCNCc1cc2ccc(OC)cc2s1 |
| InChI | InChI=1S/C18H25NOS/c1-4-6-14(5-2)9-10-19-13-17-11-15-7-8-16(20-3)12-18(15)21-17/h4,7-8,11-12,14,19H,1,5-6,9-10,13H2,2-3H3 |
| InChIKey | IXKJJFXGSMJBEW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|