C26H22N2O2S — CID 134237294
9,9-dimethyl-10-(4-pyridin-2-ylsulfonylphenyl)acridine (PubChem CID 134237294) has the molecular formula C26H22N2O2S and a molecular weight of 426.54 g/mol. Its IUPAC name is 9,9-dimethyl-10-(4-pyridin-2-ylsulfonylphenyl)acridine.
| Compound Name | 9,9-dimethyl-10-(4-pyridin-2-ylsulfonylphenyl)acridine |
|---|---|
| PubChem CID | 134237294 |
| Molecular Formula | C26H22N2O2S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 9,9-dimethyl-10-(4-pyridin-2-ylsulfonylphenyl)acridine |
| SMILES | CC1(C)c2ccccc2N(c2ccc(S(=O)(=O)c3ccccn3)cc2)c2ccccc21 |
| InChI | InChI=1S/C26H22N2O2S/c1-26(2)21-9-3-5-11-23(21)28(24-12-6-4-10-22(24)26)19-14-16-20(17-15-19)31(29,30)25-13-7-8-18-27-25/h3-18H,1-2H3 |
| InChIKey | BLLLCKXPCAAUAC-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |