C18H10F7N5O3 — CID 134240355
3-fluoro-N-[4-(trifluoromethylperoxy)-3-pyridinyl]-2-[[5-(trifluoromethyl)-2-pyridinyl]amino]pyridine-4-carboxamide (PubChem CID 134240355) has the molecular formula C18H10F7N5O3 and a molecular weight of 477.30 g/mol. Its IUPAC name is 3-fluoro-N-[4-(trifluoromethylperoxy)-3-pyridinyl]-2-[[5-(trifluoromethyl)-2-pyridinyl]amino]pyridine-4-carboxamide.
| Compound Name | 3-fluoro-N-[4-(trifluoromethylperoxy)-3-pyridinyl]-2-[[5-(trifluoromethyl)-2-pyridinyl]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 134240355 |
| Molecular Formula | C18H10F7N5O3 |
| Molecular Weight | 477.30 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | 3-fluoro-N-[4-(trifluoromethylperoxy)-3-pyridinyl]-2-[[5-(trifluoromethyl)-2-pyridinyl]amino]pyridine-4-carboxamide |
| SMILES | O=C(Nc1cnccc1OOC(F)(F)F)c1ccnc(Nc2ccc(C(F)(F)F)cn2)c1F |
| InChI | InChI=1S/C18H10F7N5O3/c19-14-10(16(31)29-11-8-26-5-4-12(11)32-33-18(23,24)25)3-6-27-15(14)30-13-2-1-9(7-28-13)17(20,21)22/h1-8H,(H,29,31)(H,27,28,30) |
| InChIKey | YNINTJYNGCDPMF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.30 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|