C10H11N3 — CID 134242600
2,6-dimethyl-6H-pyrimido[4,5-c]azepine (PubChem CID 134242600) has the molecular formula C10H11N3 and a molecular weight of 173.22 g/mol. Its IUPAC name is 2,6-dimethyl-6H-pyrimido[4,5-c]azepine.
| Compound Name | 2,6-dimethyl-6H-pyrimido[4,5-c]azepine |
|---|---|
| PubChem CID | 134242600 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 2,6-dimethyl-6H-pyrimido[4,5-c]azepine |
| SMILES | Cc1ncc2c(n1)=CN=CC(C)C=2 |
| InChI | InChI=1S/C10H11N3/c1-7-3-9-5-12-8(2)13-10(9)6-11-4-7/h3-7H,1-2H3 |
| InChIKey | PSYUMIXTHSFYSG-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |