C14H20ClN3 — CID 134243613
[2-(4-chlorocyclohexyl)-2,3-dihydroimidazo[1,2-a]pyridin-3-yl]methanamine (PubChem CID 134243613) has the molecular formula C14H20ClN3 and a molecular weight of 265.79 g/mol. Its IUPAC name is [2-(4-chlorocyclohexyl)-2,3-dihydroimidazo[1,2-a]pyridin-3-yl]methanamine.
| Compound Name | [2-(4-chlorocyclohexyl)-2,3-dihydroimidazo[1,2-a]pyridin-3-yl]methanamine |
|---|---|
| PubChem CID | 134243613 |
| Molecular Formula | C14H20ClN3 |
| Molecular Weight | 265.79 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | [2-(4-chlorocyclohexyl)-2,3-dihydroimidazo[1,2-a]pyridin-3-yl]methanamine |
| SMILES | NCC1C(C2CCC(Cl)CC2)N=C2C=CC=CN21 |
| InChI | InChI=1S/C14H20ClN3/c15-11-6-4-10(5-7-11)14-12(9-16)18-8-2-1-3-13(18)17-14/h1-3,8,10-12,14H,4-7,9,16H2 |
| InChIKey | HJGXTCALWIFCQC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.79 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|