About (3R)-2,3-dihydroimidazo[1,2-a]pyridine-3-carboxylic acid
(3R)-2,3-dihydroimidazo[1,2-a]pyridine-3-carboxylic acid (PubChem CID 93495431) has the molecular formula C8H8N2O2
and a molecular weight of 164.16 g/mol. Its IUPAC name is (3R)-2,3-dihydroimidazo[1,2-a]pyridine-3-carboxylic acid.
Analyze (3R)-2,3-dihydroimidazo[1,2-a]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-2,3-dihydroimidazo[1,2-a]pyridine-3-carboxylic acid?
The IUPAC name of (3R)-2,3-dihydroimidazo[1,2-a]pyridine-3-carboxylic acid (CID 93495431) is (3R)-2,3-dihydroimidazo[1,2-a]pyridine-3-carboxylic acid.
What is the SMILES notation for (3R)-2,3-dihydroimidazo[1,2-a]pyridine-3-carboxylic acid?
The canonical SMILES for (3R)-2,3-dihydroimidazo[1,2-a]pyridine-3-carboxylic acid is O=C(O)[C@H]1CN=C2C=CC=CN21.
What is the InChIKey of (3R)-2,3-dihydroimidazo[1,2-a]pyridine-3-carboxylic acid?
The InChIKey is WSWSTROMZJWKHZ-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H8N2O2/c11-8(12)6-5-9-7-3-1-2-4-10(6)7/h1-4,6H,5H2,(H,11,12)/t6-/m1/s1.
What are the key properties of (3R)-2,3-dihydroimidazo[1,2-a]pyridine-3-carboxylic acid?
(3R)-2,3-dihydroimidazo[1,2-a]pyridine-3-carboxylic acid has a molecular weight of 164.16 g/mol, XLogP of 0.24, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2,3-dihydroimidazo[1,2-a]pyridine-3-carboxylic acid is sourced from PubChem (CID 93495431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).