C17H23N3O4S2 — CID 134247406
methyl 7-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]heptanoate (PubChem CID 134247406) has the molecular formula C17H23N3O4S2 and a molecular weight of 397.52 g/mol. Its IUPAC name is methyl 7-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]heptanoate.
| Compound Name | methyl 7-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]heptanoate |
|---|---|
| PubChem CID | 134247406 |
| Molecular Formula | C17H23N3O4S2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | methyl 7-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]heptanoate |
| SMILES | COC(=O)CCCCCCc1cccc(S(=O)(=O)Nc2nnc(C)s2)c1 |
| InChI | InChI=1S/C17H23N3O4S2/c1-13-18-19-17(25-13)20-26(22,23)15-10-7-9-14(12-15)8-5-3-4-6-11-16(21)24-2/h7,9-10,12H,3-6,8,11H2,1-2H3,(H,19,20) |
| InChIKey | OQMIGHBSBGUQPU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|