C21H26BrNO4S — CID 134247408
7-[3-[(4-bromo-2,6-dimethylphenyl)sulfamoyl]phenyl]heptanoic acid (PubChem CID 134247408) has the molecular formula C21H26BrNO4S and a molecular weight of 468.41 g/mol. Its IUPAC name is 7-[3-[(4-bromo-2,6-dimethylphenyl)sulfamoyl]phenyl]heptanoic acid.
| Compound Name | 7-[3-[(4-bromo-2,6-dimethylphenyl)sulfamoyl]phenyl]heptanoic acid |
|---|---|
| PubChem CID | 134247408 |
| Molecular Formula | C21H26BrNO4S |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 7-[3-[(4-bromo-2,6-dimethylphenyl)sulfamoyl]phenyl]heptanoic acid |
| SMILES | Cc1cc(Br)cc(C)c1NS(=O)(=O)c1cccc(CCCCCCC(=O)O)c1 |
| InChI | InChI=1S/C21H26BrNO4S/c1-15-12-18(22)13-16(2)21(15)23-28(26,27)19-10-7-9-17(14-19)8-5-3-4-6-11-20(24)25/h7,9-10,12-14,23H,3-6,8,11H2,1-2H3,(H,24,25) |
| InChIKey | DAWXONFLFOSEDH-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|