C28H33NO5S — CID 134247412
7-[3-[(2,6-dimethyl-4-phenylmethoxyphenyl)sulfamoyl]phenyl]heptanoic acid (PubChem CID 134247412) has the molecular formula C28H33NO5S and a molecular weight of 495.64 g/mol. Its IUPAC name is 7-[3-[(2,6-dimethyl-4-phenylmethoxyphenyl)sulfamoyl]phenyl]heptanoic acid.
| Compound Name | 7-[3-[(2,6-dimethyl-4-phenylmethoxyphenyl)sulfamoyl]phenyl]heptanoic acid |
|---|---|
| PubChem CID | 134247412 |
| Molecular Formula | C28H33NO5S |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 7-[3-[(2,6-dimethyl-4-phenylmethoxyphenyl)sulfamoyl]phenyl]heptanoic acid |
| SMILES | Cc1cc(OCc2ccccc2)cc(C)c1NS(=O)(=O)c1cccc(CCCCCCC(=O)O)c1 |
| InChI | InChI=1S/C28H33NO5S/c1-21-17-25(34-20-24-12-7-5-8-13-24)18-22(2)28(21)29-35(32,33)26-15-10-14-23(19-26)11-6-3-4-9-16-27(30)31/h5,7-8,10,12-15,17-19,29H,3-4,6,9,11,16,20H2,1-2H3,(H,30,31) |
| InChIKey | PUOZZDFMOZLJJI-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|