C20H29N3O4S — CID 134247405
7-[3-(3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-ylsulfamoyl)phenyl]heptanoic acid (PubChem CID 134247405) has the molecular formula C20H29N3O4S and a molecular weight of 407.54 g/mol. Its IUPAC name is 7-[3-(3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-ylsulfamoyl)phenyl]heptanoic acid.
| Compound Name | 7-[3-(3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-ylsulfamoyl)phenyl]heptanoic acid |
|---|---|
| PubChem CID | 134247405 |
| Molecular Formula | C20H29N3O4S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 7-[3-(3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-ylsulfamoyl)phenyl]heptanoic acid |
| SMILES | O=C(O)CCCCCCc1cccc(S(=O)(=O)NC2=NC3CCCCC3N2)c1 |
| InChI | InChI=1S/C20H29N3O4S/c24-19(25)13-4-2-1-3-8-15-9-7-10-16(14-15)28(26,27)23-20-21-17-11-5-6-12-18(17)22-20/h7,9-10,14,17-18H,1-6,8,11-13H2,(H,24,25)(H2,21,22,23) |
| InChIKey | OTMSVBUQSMZMSW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|