C20H15ClN4 — CID 134264374
6-chloro-4-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethynyl]isoquinolin-3-amine (PubChem CID 134264374) has the molecular formula C20H15ClN4 and a molecular weight of 346.82 g/mol. Its IUPAC name is 6-chloro-4-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethynyl]isoquinolin-3-amine.
| Compound Name | 6-chloro-4-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethynyl]isoquinolin-3-amine |
|---|---|
| PubChem CID | 134264374 |
| Molecular Formula | C20H15ClN4 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 6-chloro-4-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethynyl]isoquinolin-3-amine |
| SMILES | Nc1ncc2ccc(Cl)cc2c1C#Cc1ccc(C2=NCCN2)cc1 |
| InChI | InChI=1S/C20H15ClN4/c21-16-7-6-15-12-25-19(22)17(18(15)11-16)8-3-13-1-4-14(5-2-13)20-23-9-10-24-20/h1-2,4-7,11-12H,9-10H2,(H2,22,25)(H,23,24) |
| InChIKey | HLJKGYAKBXNVDB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|