C16H13ClN6 — CID 118687518
4-[(3-amino-6-chloroisoquinolin-4-yl)diazenyl]benzenecarboximidamide (PubChem CID 118687518) has the molecular formula C16H13ClN6 and a molecular weight of 324.78 g/mol. Its IUPAC name is 4-[(3-amino-6-chloroisoquinolin-4-yl)diazenyl]benzenecarboximidamide.
| Compound Name | 4-[(3-amino-6-chloroisoquinolin-4-yl)diazenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 118687518 |
| Molecular Formula | C16H13ClN6 |
| Molecular Weight | 324.78 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 4-[(3-amino-6-chloroisoquinolin-4-yl)diazenyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(/N=N/c2c(N)ncc3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C16H13ClN6/c17-11-4-1-10-8-21-16(20)14(13(10)7-11)23-22-12-5-2-9(3-6-12)15(18)19/h1-8H,(H3,18,19)(H2,20,21)/b23-22+ |
| InChIKey | LUCBVWQDQMVRTK-GHVJWSGMSA-N |
| XLogP | 4.17 |
| TPSA | 113.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.78 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|