C16H35N3O3 — CID 134266528
N-[2-[2-[2-(tert-butylamino)ethoxy]propan-2-yloxy]ethyl]-3-(ethylamino)propanamide (PubChem CID 134266528) has the molecular formula C16H35N3O3 and a molecular weight of 317.47 g/mol. Its IUPAC name is N-[2-[2-[2-(tert-butylamino)ethoxy]propan-2-yloxy]ethyl]-3-(ethylamino)propanamide.
| Compound Name | N-[2-[2-[2-(tert-butylamino)ethoxy]propan-2-yloxy]ethyl]-3-(ethylamino)propanamide |
|---|---|
| PubChem CID | 134266528 |
| Molecular Formula | C16H35N3O3 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | N-[2-[2-[2-(tert-butylamino)ethoxy]propan-2-yloxy]ethyl]-3-(ethylamino)propanamide |
| SMILES | CCNCCC(=O)NCCOC(C)(C)OCCNC(C)(C)C |
| InChI | InChI=1S/C16H35N3O3/c1-7-17-9-8-14(20)18-10-12-21-16(5,6)22-13-11-19-15(2,3)4/h17,19H,7-13H2,1-6H3,(H,18,20) |
| InChIKey | LJEKICSLMKQGIQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|