C27H54N4O4 — CID 135302838
6-(tert-butylamino)-N-[2-[1-[2-[3-(tert-butylamino)propanoylamino]ethoxy]cyclohexyl]oxyethyl]hexanamide (PubChem CID 135302838) has the molecular formula C27H54N4O4 and a molecular weight of 498.75 g/mol. Its IUPAC name is 6-(tert-butylamino)-N-[2-[1-[2-[3-(tert-butylamino)propanoylamino]ethoxy]cyclohexyl]oxyethyl]hexanamide.
| Compound Name | 6-(tert-butylamino)-N-[2-[1-[2-[3-(tert-butylamino)propanoylamino]ethoxy]cyclohexyl]oxyethyl]hexanamide |
|---|---|
| PubChem CID | 135302838 |
| Molecular Formula | C27H54N4O4 |
| Molecular Weight | 498.75 g/mol |
| Exact Mass | 498.41 |
| IUPAC Name | 6-(tert-butylamino)-N-[2-[1-[2-[3-(tert-butylamino)propanoylamino]ethoxy]cyclohexyl]oxyethyl]hexanamide |
| SMILES | CC(C)(C)NCCCCCC(=O)NCCOC1(OCCNC(=O)CCNC(C)(C)C)CCCCC1 |
| InChI | InChI=1S/C27H54N4O4/c1-25(2,3)30-17-12-7-9-13-23(32)28-19-21-34-27(15-10-8-11-16-27)35-22-20-29-24(33)14-18-31-26(4,5)6/h30-31H,7-22H2,1-6H3,(H,28,32)(H,29,33) |
| InChIKey | SGJVVPLVZOPLIN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.75 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|