C18H32O4 — CID 134266997
(3R)-6-ethoxy-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbutyl)oxiran-2-yl]-1-oxaspiro[2.5]octane (PubChem CID 134266997) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is (3R)-6-ethoxy-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbutyl)oxiran-2-yl]-1-oxaspiro[2.5]octane.
| Compound Name | (3R)-6-ethoxy-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbutyl)oxiran-2-yl]-1-oxaspiro[2.5]octane |
|---|---|
| PubChem CID | 134266997 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | (3R)-6-ethoxy-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbutyl)oxiran-2-yl]-1-oxaspiro[2.5]octane |
| SMILES | CCOC1CC[C@]2(CO2)C(C2(C)O[C@@H]2CCC(C)C)C1OC |
| InChI | InChI=1S/C18H32O4/c1-6-20-13-9-10-18(11-21-18)16(15(13)19-5)17(4)14(22-17)8-7-12(2)3/h12-16H,6-11H2,1-5H3/t13?,14-,15?,16?,17?,18+/m1/s1 |
| InChIKey | RPBWCJHLISUYPO-SARKOLRYSA-N |
| XLogP | 3.18 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|