C24H42N2O7 — CID 88870452
methyl 6-amino-2-[[(3R)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbutyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]hexanoate (PubChem CID 88870452) has the molecular formula C24H42N2O7 and a molecular weight of 470.61 g/mol. Its IUPAC name is methyl 6-amino-2-[[(3R)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbutyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]hexanoate.
| Compound Name | methyl 6-amino-2-[[(3R)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbutyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 88870452 |
| Molecular Formula | C24H42N2O7 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | methyl 6-amino-2-[[(3R)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbutyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]hexanoate |
| SMILES | COC(=O)C(CCCCN)NC(=O)OC1CC[C@]2(CO2)C(C2(C)O[C@@H]2CCC(C)C)C1OC |
| InChI | InChI=1S/C24H42N2O7/c1-15(2)9-10-18-23(3,33-18)20-19(29-4)17(11-12-24(20)14-31-24)32-22(28)26-16(21(27)30-5)8-6-7-13-25/h15-20H,6-14,25H2,1-5H3,(H,26,28)/t16?,17?,18-,19?,20?,23?,24+/m1/s1 |
| InChIKey | PITIPJWEFPKBMY-IGQWKHCCSA-N |
| XLogP | 2.54 |
| TPSA | 124.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|