C12H13F3O7S — CID 134267080
3,3,3-trifluoro-2-(3-oxo-2-oxatricyclo[3.2.1.11,4]nonane-6-carbonyl)oxypropane-1-sulfonic acid (PubChem CID 134267080) has the molecular formula C12H13F3O7S and a molecular weight of 358.29 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(3-oxo-2-oxatricyclo[3.2.1.11,4]nonane-6-carbonyl)oxypropane-1-sulfonic acid.
| Compound Name | 3,3,3-trifluoro-2-(3-oxo-2-oxatricyclo[3.2.1.11,4]nonane-6-carbonyl)oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 134267080 |
| Molecular Formula | C12H13F3O7S |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 3,3,3-trifluoro-2-(3-oxo-2-oxatricyclo[3.2.1.11,4]nonane-6-carbonyl)oxypropane-1-sulfonic acid |
| SMILES | O=C(OC(CS(=O)(=O)O)C(F)(F)F)C1CC23CC(C(=O)O2)C1C3 |
| InChI | InChI=1S/C12H13F3O7S/c13-12(14,15)8(4-23(18,19)20)21-9(16)6-2-11-1-5(6)7(3-11)10(17)22-11/h5-8H,1-4H2,(H,18,19,20) |
| InChIKey | ONJMWCPBFKNDNO-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|