C14H15F3O9S — CID 129061628
3,3,3-trifluoro-2-[2-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-2-carbonyl)oxyacetyl]oxypropane-1-sulfonic acid (PubChem CID 129061628) has the molecular formula C14H15F3O9S and a molecular weight of 416.33 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[2-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-2-carbonyl)oxyacetyl]oxypropane-1-sulfonic acid.
| Compound Name | 3,3,3-trifluoro-2-[2-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-2-carbonyl)oxyacetyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 129061628 |
| Molecular Formula | C14H15F3O9S |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 3,3,3-trifluoro-2-[2-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-2-carbonyl)oxyacetyl]oxypropane-1-sulfonic acid |
| SMILES | O=C(COC(=O)C1C2CC3C(=O)OC1C3C2)OC(CS(=O)(=O)O)C(F)(F)F |
| InChI | InChI=1S/C14H15F3O9S/c15-14(16,17)8(4-27(21,22)23)25-9(18)3-24-13(20)10-5-1-6-7(2-5)12(19)26-11(6)10/h5-8,10-11H,1-4H2,(H,21,22,23) |
| InChIKey | WJINGOZOTFZTTR-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|