C12H11F5O7S — CID 129070130
1,1,3,3,3-pentafluoro-2-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-2-carbonyl)oxypropane-1-sulfonic acid (PubChem CID 129070130) has the molecular formula C12H11F5O7S and a molecular weight of 394.27 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-2-carbonyl)oxypropane-1-sulfonic acid.
| Compound Name | 1,1,3,3,3-pentafluoro-2-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-2-carbonyl)oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 129070130 |
| Molecular Formula | C12H11F5O7S |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-2-carbonyl)oxypropane-1-sulfonic acid |
| SMILES | O=C1OC2C3CC(CC13)C2C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C12H11F5O7S/c13-11(14,15)10(12(16,17)25(20,21)22)24-9(19)6-3-1-4-5(2-3)8(18)23-7(4)6/h3-7,10H,1-2H2,(H,20,21,22) |
| InChIKey | CEZVAEWVCMAVRN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|