About 4-methyl-3,5-di(propan-2-yl)-4,5-dihydro-1,2-oxazole
4-methyl-3,5-di(propan-2-yl)-4,5-dihydro-1,2-oxazole (PubChem CID 134267440) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is 4-methyl-3,5-di(propan-2-yl)-4,5-dihydro-1,2-oxazole.
Analyze 4-methyl-3,5-di(propan-2-yl)-4,5-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3,5-di(propan-2-yl)-4,5-dihydro-1,2-oxazole?
The IUPAC name of 4-methyl-3,5-di(propan-2-yl)-4,5-dihydro-1,2-oxazole (CID 134267440) is 4-methyl-3,5-di(propan-2-yl)-4,5-dihydro-1,2-oxazole.
What is the SMILES notation for 4-methyl-3,5-di(propan-2-yl)-4,5-dihydro-1,2-oxazole?
The canonical SMILES for 4-methyl-3,5-di(propan-2-yl)-4,5-dihydro-1,2-oxazole is CC(C)C1=NOC(C(C)C)C1C.
What is the InChIKey of 4-methyl-3,5-di(propan-2-yl)-4,5-dihydro-1,2-oxazole?
The InChIKey is BIZUTQHLIODTJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO/c1-6(2)9-8(5)10(7(3)4)12-11-9/h6-8,10H,1-5H3.
What are the key properties of 4-methyl-3,5-di(propan-2-yl)-4,5-dihydro-1,2-oxazole?
4-methyl-3,5-di(propan-2-yl)-4,5-dihydro-1,2-oxazole has a molecular weight of 169.27 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3,5-di(propan-2-yl)-4,5-dihydro-1,2-oxazole is sourced from PubChem (CID 134267440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).