C20H16F5N5O2 — CID 134267733
6-(1,3-oxazolidin-3-yl)-N-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-5-(1H-pyrazol-5-yl)pyridine-3-carboxamide (PubChem CID 134267733) has the molecular formula C20H16F5N5O2 and a molecular weight of 453.37 g/mol. Its IUPAC name is 6-(1,3-oxazolidin-3-yl)-N-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-5-(1H-pyrazol-5-yl)pyridine-3-carboxamide.
| Compound Name | 6-(1,3-oxazolidin-3-yl)-N-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-5-(1H-pyrazol-5-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 134267733 |
| Molecular Formula | C20H16F5N5O2 |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 6-(1,3-oxazolidin-3-yl)-N-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-5-(1H-pyrazol-5-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)C(F)(F)F)cc1)c1cnc(N2CCOC2)c(-c2ccn[nH]2)c1 |
| InChI | InChI=1S/C20H16F5N5O2/c21-19(22,20(23,24)25)13-1-3-14(4-2-13)28-18(31)12-9-15(16-5-6-27-29-16)17(26-10-12)30-7-8-32-11-30/h1-6,9-10H,7-8,11H2,(H,27,29)(H,28,31) |
| InChIKey | BTVRNDARXPAZFW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|