C24H22ClF2N3O5S — CID 166662280
N-[4-[chloro(difluoro)methoxy]phenyl]-5-(3-methylsulfonylphenyl)-6-morpholin-4-ylpyridine-3-carboxamide (PubChem CID 166662280) has the molecular formula C24H22ClF2N3O5S and a molecular weight of 537.97 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-5-(3-methylsulfonylphenyl)-6-morpholin-4-ylpyridine-3-carboxamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-5-(3-methylsulfonylphenyl)-6-morpholin-4-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 166662280 |
| Molecular Formula | C24H22ClF2N3O5S |
| Molecular Weight | 537.97 g/mol |
| Exact Mass | 537.09 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-5-(3-methylsulfonylphenyl)-6-morpholin-4-ylpyridine-3-carboxamide |
| SMILES | CS(=O)(=O)c1cccc(-c2cc(C(=O)Nc3ccc(OC(F)(F)Cl)cc3)cnc2N2CCOCC2)c1 |
| InChI | InChI=1S/C24H22ClF2N3O5S/c1-36(32,33)20-4-2-3-16(13-20)21-14-17(15-28-22(21)30-9-11-34-12-10-30)23(31)29-18-5-7-19(8-6-18)35-24(25,26)27/h2-8,13-15H,9-12H2,1H3,(H,29,31) |
| InChIKey | WPQYRRGBSCSBTA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.97 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|