C14H25NO4S2 — CID 134267815
1,2-bis(cyclohexylsulfonyl)ethanimine (PubChem CID 134267815) has the molecular formula C14H25NO4S2 and a molecular weight of 335.49 g/mol. Its IUPAC name is 1,2-bis(cyclohexylsulfonyl)ethanimine.
| Compound Name | 1,2-bis(cyclohexylsulfonyl)ethanimine |
|---|---|
| PubChem CID | 134267815 |
| Molecular Formula | C14H25NO4S2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 1,2-bis(cyclohexylsulfonyl)ethanimine |
| SMILES | [H]/N=C(\CS(=O)(=O)C1CCCCC1)S(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C14H25NO4S2/c15-14(21(18,19)13-9-5-2-6-10-13)11-20(16,17)12-7-3-1-4-8-12/h12-13,15H,1-11H2/b15-14+ |
| InChIKey | KDOVBSGYFHPSJC-CCEZHUSRSA-N |
| XLogP | 2.46 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|