C13H18O3S2 — CID 64635420
2-cyclohexylsulfonyl-1-(5-methylthiophen-2-yl)ethanone (PubChem CID 64635420) has the molecular formula C13H18O3S2 and a molecular weight of 286.42 g/mol. Its IUPAC name is 2-cyclohexylsulfonyl-1-(5-methylthiophen-2-yl)ethanone.
| Compound Name | 2-cyclohexylsulfonyl-1-(5-methylthiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 64635420 |
| Molecular Formula | C13H18O3S2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-cyclohexylsulfonyl-1-(5-methylthiophen-2-yl)ethanone |
| SMILES | Cc1ccc(C(=O)CS(=O)(=O)C2CCCCC2)s1 |
| InChI | InChI=1S/C13H18O3S2/c1-10-7-8-13(17-10)12(14)9-18(15,16)11-5-3-2-4-6-11/h7-8,11H,2-6,9H2,1H3 |
| InChIKey | CGYAGFZFJPOHOG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |