C13H17ClO3S2 — CID 64635814
1-(5-chlorothiophen-2-yl)-2-(3-methylcyclohexyl)sulfonylethanone (PubChem CID 64635814) has the molecular formula C13H17ClO3S2 and a molecular weight of 320.86 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-2-(3-methylcyclohexyl)sulfonylethanone.
| Compound Name | 1-(5-chlorothiophen-2-yl)-2-(3-methylcyclohexyl)sulfonylethanone |
|---|---|
| PubChem CID | 64635814 |
| Molecular Formula | C13H17ClO3S2 |
| Molecular Weight | 320.86 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-2-(3-methylcyclohexyl)sulfonylethanone |
| SMILES | CC1CCCC(S(=O)(=O)CC(=O)c2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C13H17ClO3S2/c1-9-3-2-4-10(7-9)19(16,17)8-11(15)12-5-6-13(14)18-12/h5-6,9-10H,2-4,7-8H2,1H3 |
| InChIKey | ZOWIFVXIQUDHKD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.86 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |