C15H19BrO3S — CID 64636006
1-(2-bromophenyl)-2-(3-methylcyclohexyl)sulfonylethanone (PubChem CID 64636006) has the molecular formula C15H19BrO3S and a molecular weight of 359.29 g/mol. Its IUPAC name is 1-(2-bromophenyl)-2-(3-methylcyclohexyl)sulfonylethanone.
| Compound Name | 1-(2-bromophenyl)-2-(3-methylcyclohexyl)sulfonylethanone |
|---|---|
| PubChem CID | 64636006 |
| Molecular Formula | C15H19BrO3S |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 1-(2-bromophenyl)-2-(3-methylcyclohexyl)sulfonylethanone |
| SMILES | CC1CCCC(S(=O)(=O)CC(=O)c2ccccc2Br)C1 |
| InChI | InChI=1S/C15H19BrO3S/c1-11-5-4-6-12(9-11)20(18,19)10-15(17)13-7-2-3-8-14(13)16/h2-3,7-8,11-12H,4-6,9-10H2,1H3 |
| InChIKey | ONRMBDPGUPJHOU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |