C22H20F3N5O3S — CID 134268718
3-[2-[4-(cyclopropanecarbonyl)piperazin-1-yl]pyrimidin-5-yl]-5-(trifluoromethylsulfanyloxy)-2H-isoquinolin-1-one (PubChem CID 134268718) has the molecular formula C22H20F3N5O3S and a molecular weight of 491.50 g/mol. Its IUPAC name is 3-[2-[4-(cyclopropanecarbonyl)piperazin-1-yl]pyrimidin-5-yl]-5-(trifluoromethylsulfanyloxy)-2H-isoquinolin-1-one.
| Compound Name | 3-[2-[4-(cyclopropanecarbonyl)piperazin-1-yl]pyrimidin-5-yl]-5-(trifluoromethylsulfanyloxy)-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 134268718 |
| Molecular Formula | C22H20F3N5O3S |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 3-[2-[4-(cyclopropanecarbonyl)piperazin-1-yl]pyrimidin-5-yl]-5-(trifluoromethylsulfanyloxy)-2H-isoquinolin-1-one |
| SMILES | O=C(C1CC1)N1CCN(c2ncc(-c3cc4c(OSC(F)(F)F)cccc4c(=O)[nH]3)cn2)CC1 |
| InChI | InChI=1S/C22H20F3N5O3S/c23-22(24,25)34-33-18-3-1-2-15-16(18)10-17(28-19(15)31)14-11-26-21(27-12-14)30-8-6-29(7-9-30)20(32)13-4-5-13/h1-3,10-13H,4-9H2,(H,28,31) |
| InChIKey | XQAVUZUECPIJLV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|