C24H25F3N6O5S — CID 134281603
[(3R)-3-[5-[3-[5-(2,2-difluoroethoxy)pyrazin-2-yl]-1,2-oxazol-5-yl]-2-fluorophenyl]-3,6,6-trimethyl-1-methylimino-1-oxo-2H-1,4-thiazin-5-yl]carbamic acid (PubChem CID 134281603) has the molecular formula C24H25F3N6O5S and a molecular weight of 566.56 g/mol. Its IUPAC name is [(3R)-3-[5-[3-[5-(2,2-difluoroethoxy)pyrazin-2-yl]-1,2-oxazol-5-yl]-2-fluorophenyl]-3,6,6-trimethyl-1-methylimino-1-oxo-2H-1,4-thiazin-5-yl]carbamic acid.
| Compound Name | [(3R)-3-[5-[3-[5-(2,2-difluoroethoxy)pyrazin-2-yl]-1,2-oxazol-5-yl]-2-fluorophenyl]-3,6,6-trimethyl-1-methylimino-1-oxo-2H-1,4-thiazin-5-yl]carbamic acid |
|---|---|
| PubChem CID | 134281603 |
| Molecular Formula | C24H25F3N6O5S |
| Molecular Weight | 566.56 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | [(3R)-3-[5-[3-[5-(2,2-difluoroethoxy)pyrazin-2-yl]-1,2-oxazol-5-yl]-2-fluorophenyl]-3,6,6-trimethyl-1-methylimino-1-oxo-2H-1,4-thiazin-5-yl]carbamic acid |
| SMILES | CN=S1(=O)C[C@@](C)(c2cc(-c3cc(-c4cnc(OCC(F)F)cn4)no3)ccc2F)N=C(NC(=O)O)C1(C)C |
| InChI | InChI=1S/C24H25F3N6O5S/c1-23(2)21(31-22(34)35)32-24(3,12-39(23,36)28-4)14-7-13(5-6-15(14)25)18-8-16(33-38-18)17-9-30-20(10-29-17)37-11-19(26)27/h5-10,19H,11-12H2,1-4H3,(H,31,32)(H,34,35)/t24-,39?/m0/s1 |
| InChIKey | BWBCUOALYNGYFV-ONZSSFSLSA-N |
| XLogP | 4.35 |
| TPSA | 152.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |