C23H24ClFN6O2S — CID 155155910
(1R,3R)-3-[5-[3-(5-chloropyrazin-2-yl)-1,2-oxazol-5-yl]-2-fluorophenyl]-1-cyclopropylimino-3,6,6-trimethyl-1-oxo-2H-1,4-thiazin-5-amine (PubChem CID 155155910) has the molecular formula C23H24ClFN6O2S and a molecular weight of 503.00 g/mol. Its IUPAC name is (1R,3R)-3-[5-[3-(5-chloropyrazin-2-yl)-1,2-oxazol-5-yl]-2-fluorophenyl]-1-cyclopropylimino-3,6,6-trimethyl-1-oxo-2H-1,4-thiazin-5-amine.
| Compound Name | (1R,3R)-3-[5-[3-(5-chloropyrazin-2-yl)-1,2-oxazol-5-yl]-2-fluorophenyl]-1-cyclopropylimino-3,6,6-trimethyl-1-oxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 155155910 |
| Molecular Formula | C23H24ClFN6O2S |
| Molecular Weight | 503.00 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | (1R,3R)-3-[5-[3-(5-chloropyrazin-2-yl)-1,2-oxazol-5-yl]-2-fluorophenyl]-1-cyclopropylimino-3,6,6-trimethyl-1-oxo-2H-1,4-thiazin-5-amine |
| SMILES | CC1(C)C(N)=N[C@](C)(c2cc(-c3cc(-c4cnc(Cl)cn4)no3)ccc2F)C[S@]1(=O)=NC1CC1 |
| InChI | InChI=1S/C23H24ClFN6O2S/c1-22(2)21(26)29-23(3,12-34(22,32)31-14-5-6-14)15-8-13(4-7-16(15)25)19-9-17(30-33-19)18-10-28-20(24)11-27-18/h4,7-11,14H,5-6,12H2,1-3H3,(H2,26,29)/t23-,34+/m0/s1 |
| InChIKey | OGHNZRRMPGDQFX-OHWKKVTOSA-N |
| XLogP | 4.59 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.00 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |