C11H16FNO5 — CID 134284993
(2S,4R)-4-fluoro-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]pyrrolidine-2-carboxylic acid (PubChem CID 134284993) has the molecular formula C11H16FNO5 and a molecular weight of 261.25 g/mol. Its IUPAC name is (2S,4R)-4-fluoro-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-4-fluoro-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 134284993 |
| Molecular Formula | C11H16FNO5 |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (2S,4R)-4-fluoro-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)C(=O)N1C[C@H](F)C[C@H]1C(=O)O |
| InChI | InChI=1S/C11H16FNO5/c1-11(2,3)18-10(17)8(14)13-5-6(12)4-7(13)9(15)16/h6-7H,4-5H2,1-3H3,(H,15,16)/t6-,7+/m1/s1 |
| InChIKey | CHYMSTOABGKDIQ-RQJHMYQMSA-N |
| XLogP | 0.35 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|