C25H27IN4O3S — CID 134286178
1-(4-iodophenyl)-3-[3-(nitrosomethyl)-6-(3-phenylmethoxypropyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]urea (PubChem CID 134286178) has the molecular formula C25H27IN4O3S and a molecular weight of 590.49 g/mol. Its IUPAC name is 1-(4-iodophenyl)-3-[3-(nitrosomethyl)-6-(3-phenylmethoxypropyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]urea.
| Compound Name | 1-(4-iodophenyl)-3-[3-(nitrosomethyl)-6-(3-phenylmethoxypropyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]urea |
|---|---|
| PubChem CID | 134286178 |
| Molecular Formula | C25H27IN4O3S |
| Molecular Weight | 590.49 g/mol |
| Exact Mass | 590.08 |
| IUPAC Name | 1-(4-iodophenyl)-3-[3-(nitrosomethyl)-6-(3-phenylmethoxypropyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]urea |
| SMILES | O=NCc1c(NC(=O)Nc2ccc(I)cc2)sc2c1CCN(CCCOCc1ccccc1)C2 |
| InChI | InChI=1S/C25H27IN4O3S/c26-19-7-9-20(10-8-19)28-25(31)29-24-22(15-27-32)21-11-13-30(16-23(21)34-24)12-4-14-33-17-18-5-2-1-3-6-18/h1-3,5-10H,4,11-17H2,(H2,28,29,31) |
| InChIKey | HNYVNBGYUVZWRQ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.49 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|