C29H29ClN4O3 — CID 134286997
1'-[(5-chloro-1-pent-4-ynylindol-2-yl)methyl]-N-(3-hydroxycyclobutyl)-2'-oxospiro[azetidine-3,3'-indole]-1-carboxamide (PubChem CID 134286997) has the molecular formula C29H29ClN4O3 and a molecular weight of 517.03 g/mol. Its IUPAC name is 1'-[(5-chloro-1-pent-4-ynylindol-2-yl)methyl]-N-(3-hydroxycyclobutyl)-2'-oxospiro[azetidine-3,3'-indole]-1-carboxamide.
| Compound Name | 1'-[(5-chloro-1-pent-4-ynylindol-2-yl)methyl]-N-(3-hydroxycyclobutyl)-2'-oxospiro[azetidine-3,3'-indole]-1-carboxamide |
|---|---|
| PubChem CID | 134286997 |
| Molecular Formula | C29H29ClN4O3 |
| Molecular Weight | 517.03 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 1'-[(5-chloro-1-pent-4-ynylindol-2-yl)methyl]-N-(3-hydroxycyclobutyl)-2'-oxospiro[azetidine-3,3'-indole]-1-carboxamide |
| SMILES | C#CCCCn1c(CN2C(=O)C3(CN(C(=O)NC4CC(O)C4)C3)c3ccccc32)cc2cc(Cl)ccc21 |
| InChI | InChI=1S/C29H29ClN4O3/c1-2-3-6-11-33-22(13-19-12-20(30)9-10-25(19)33)16-34-26-8-5-4-7-24(26)29(27(34)36)17-32(18-29)28(37)31-21-14-23(35)15-21/h1,4-5,7-10,12-13,21,23,35H,3,6,11,14-18H2,(H,31,37) |
| InChIKey | KNVFLPCGFNQDOC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.03 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|