C27H33ClN2O — CID 134286965
1-[(1-butyl-5-chloroindol-2-yl)methyl]-3-ethyl-3-(2-methylpropyl)indol-2-one (PubChem CID 134286965) has the molecular formula C27H33ClN2O and a molecular weight of 437.03 g/mol. Its IUPAC name is 1-[(1-butyl-5-chloroindol-2-yl)methyl]-3-ethyl-3-(2-methylpropyl)indol-2-one.
| Compound Name | 1-[(1-butyl-5-chloroindol-2-yl)methyl]-3-ethyl-3-(2-methylpropyl)indol-2-one |
|---|---|
| PubChem CID | 134286965 |
| Molecular Formula | C27H33ClN2O |
| Molecular Weight | 437.03 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 1-[(1-butyl-5-chloroindol-2-yl)methyl]-3-ethyl-3-(2-methylpropyl)indol-2-one |
| SMILES | CCCCn1c(CN2C(=O)C(CC)(CC(C)C)c3ccccc32)cc2cc(Cl)ccc21 |
| InChI | InChI=1S/C27H33ClN2O/c1-5-7-14-29-22(16-20-15-21(28)12-13-24(20)29)18-30-25-11-9-8-10-23(25)27(6-2,26(30)31)17-19(3)4/h8-13,15-16,19H,5-7,14,17-18H2,1-4H3 |
| InChIKey | TWICLTQSPJEEAB-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.03 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |