C27H27ClN4O2 — CID 144607605
4-[5-chloro-2-[[1-(2-methylpropanoyl)-2'-oxospiro[azetidine-3,3'-indole]-1'-yl]methyl]indol-1-yl]butanenitrile (PubChem CID 144607605) has the molecular formula C27H27ClN4O2 and a molecular weight of 474.99 g/mol. Its IUPAC name is 4-[5-chloro-2-[[1-(2-methylpropanoyl)-2'-oxospiro[azetidine-3,3'-indole]-1'-yl]methyl]indol-1-yl]butanenitrile.
| Compound Name | 4-[5-chloro-2-[[1-(2-methylpropanoyl)-2'-oxospiro[azetidine-3,3'-indole]-1'-yl]methyl]indol-1-yl]butanenitrile |
|---|---|
| PubChem CID | 144607605 |
| Molecular Formula | C27H27ClN4O2 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 4-[5-chloro-2-[[1-(2-methylpropanoyl)-2'-oxospiro[azetidine-3,3'-indole]-1'-yl]methyl]indol-1-yl]butanenitrile |
| SMILES | CC(C)C(=O)N1CC2(C1)C(=O)N(Cc1cc3cc(Cl)ccc3n1CCCC#N)c1ccccc12 |
| InChI | InChI=1S/C27H27ClN4O2/c1-18(2)25(33)30-16-27(17-30)22-7-3-4-8-24(22)32(26(27)34)15-21-14-19-13-20(28)9-10-23(19)31(21)12-6-5-11-29/h3-4,7-10,13-14,18H,5-6,12,15-17H2,1-2H3 |
| InChIKey | YZIXRJSKVRMAFX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 69.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|