C11H14N2 — CID 134289682
2-methyl-4-(3-methylphenyl)-1,5-dihydropyrazole (PubChem CID 134289682) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 2-methyl-4-(3-methylphenyl)-1,5-dihydropyrazole.
| Compound Name | 2-methyl-4-(3-methylphenyl)-1,5-dihydropyrazole |
|---|---|
| PubChem CID | 134289682 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2-methyl-4-(3-methylphenyl)-1,5-dihydropyrazole |
| SMILES | Cc1cccc(C2=CN(C)NC2)c1 |
| InChI | InChI=1S/C11H14N2/c1-9-4-3-5-10(6-9)11-7-12-13(2)8-11/h3-6,8,12H,7H2,1-2H3 |
| InChIKey | UCTOWAGIJXZQEX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |