C18H20ClN — CID 19095582
1-benzyl-4-(3-methylphenyl)-2,3-dihydropyrrole;hydrochloride (PubChem CID 19095582) has the molecular formula C18H20ClN and a molecular weight of 285.82 g/mol. Its IUPAC name is 1-benzyl-4-(3-methylphenyl)-2,3-dihydropyrrole;hydrochloride.
| Compound Name | 1-benzyl-4-(3-methylphenyl)-2,3-dihydropyrrole;hydrochloride |
|---|---|
| PubChem CID | 19095582 |
| Molecular Formula | C18H20ClN |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 1-benzyl-4-(3-methylphenyl)-2,3-dihydropyrrole;hydrochloride |
| SMILES | Cc1cccc(C2=CN(Cc3ccccc3)CC2)c1.Cl |
| InChI | InChI=1S/C18H19N.ClH/c1-15-6-5-9-17(12-15)18-10-11-19(14-18)13-16-7-3-2-4-8-16;/h2-9,12,14H,10-11,13H2,1H3;1H |
| InChIKey | RESWCEVLMQVZDK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |